CAS 1142198-17-1 is the registry number for Methyl (3,4,5-triethoxy-2-nitrophenyl)acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 10g, 25g, 1g.
Methyl 2-(3,4,5-triethoxy-2-nitrophenyl)acetate (CAS 1142198-17-1) is a chemical compound with the molecular formula C15H21NO7 and a molecular weight of 327.33 g/mol. IUPAC name: methyl 2-(3,4,5-triethoxy-2-nitrophenyl)acetate. InChIKey: RTEJDAWLBLDSBB-UHFFFAOYSA-N.
| Molecular formula | C15H21NO7 |
|---|---|
| Molecular weight | 327.33 g/mol |
| IUPAC name | methyl 2-(3,4,5-triethoxy-2-nitrophenyl)acetate |
| InChIKey | RTEJDAWLBLDSBB-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C(=C(C(=C1)CC(=O)OC)[N+](=O)[O-])OCC)OCC |
Computed by PubChem (NCBI)