Products 1246616-75-0

CAS 1246616-75-0 is the registry number for 1-(2,2-Dimethoxyethyl)-1,4-dihydro-4-oxo-2,5-pyridinedicarboxylic Acid 2,5-Diethyl Ester. Offered by: TRC. Available pack sizes: 100mg.

Structural formula: {0} (CAS {1})

Diethyl 1-(2,2-dimethoxyethyl)-4-oxopyridine-2,5-dicarboxylate (CAS 1246616-75-0) is a chemical compound with the molecular formula C15H21NO7 and a molecular weight of 327.33 g/mol. IUPAC name: diethyl 1-(2,2-dimethoxyethyl)-4-oxopyridine-2,5-dicarboxylate. InChIKey: UURPNOXFSMLWLF-UHFFFAOYSA-N.

Identity
Molecular formulaC15H21NO7
Molecular weight327.33 g/mol
IUPAC namediethyl 1-(2,2-dimethoxyethyl)-4-oxopyridine-2,5-dicarboxylate
InChIKeyUURPNOXFSMLWLF-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CC(=O)C(=CN1CC(OC)OC)C(=O)OCC

Computed by PubChem (NCBI)