Products 31105-03-0
CAS 31105-03-0 appears in our catalog under these names: (3S,4R,5R)-3,4,5,6-Tetrahydroxy-2-oxohexyl L-phenylalaninate, 98%, Fructose-phenylalanine (mixture of diastereomers), Fructose-phenylalanine. Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 100mg, 10mg, 5 mg, 1 mg.
(2S)-3-phenyl-2-[[(3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexyl]amino]propanoic acid (CAS 31105-03-0) is a chemical compound with the molecular formula C15H21NO7 and a molecular weight of 327.33 g/mol. IUPAC name: (2S)-3-phenyl-2-[[(3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexyl]amino]propanoic acid. InChIKey: WZWDUEKBAIXVCC-IGHBBLSQSA-N.
| Molecular formula | C15H21NO7 |
|---|---|
| Molecular weight | 327.33 g/mol |
| IUPAC name | (2S)-3-phenyl-2-[[(3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexyl]amino]propanoic acid |
| InChIKey | WZWDUEKBAIXVCC-IGHBBLSQSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)O)NCC(=O)[C@H]([C@@H]([C@@H](CO)O)O)O |
Computed by PubChem (NCBI)