CAS 1142202-64-9 appears in our catalog under these names: 3-[3-Ethyl-1-(4-isopropylphenyl)-1h-1,2,4-triazol-5-yl]propanoic acid, 95%, 3-(3-Ethyl-1-(4-isopropylphenyl)-1H-1,2,4-triazol-5-yl)propanoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
3-[5-ethyl-2-(4-propan-2-ylphenyl)-1,2,4-triazol-3-yl]propanoic acid (CAS 1142202-64-9) is a chemical compound with the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. IUPAC name: 3-[5-ethyl-2-(4-propan-2-ylphenyl)-1,2,4-triazol-3-yl]propanoic acid. InChIKey: ZYQUELZWZTXGAD-UHFFFAOYSA-N.
| Molecular formula | C16H21N3O2 |
|---|---|
| Molecular weight | 287.36 g/mol |
| IUPAC name | 3-[5-ethyl-2-(4-propan-2-ylphenyl)-1,2,4-triazol-3-yl]propanoic acid |
| InChIKey | ZYQUELZWZTXGAD-UHFFFAOYSA-N |
| SMILES | CCC1=NN(C(=N1)CCC(=O)O)C2=CC=C(C=C2)C(C)C |
Computed by PubChem (NCBI)