CAS 725685-92-7 is the registry number for Ethyl 3-(5-amino-3-tert-butyl-1h-pyrazol-1-yl)benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Ethyl 3-(5-amino-3-tert-butylpyrazol-1-yl)benzoate (CAS 725685-92-7) is a chemical compound with the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. IUPAC name: ethyl 3-(5-amino-3-tert-butylpyrazol-1-yl)benzoate. InChIKey: KQBTZSUKLIBZJW-UHFFFAOYSA-N.
| Molecular formula | C16H21N3O2 |
|---|---|
| Molecular weight | 287.36 g/mol |
| IUPAC name | ethyl 3-(5-amino-3-tert-butylpyrazol-1-yl)benzoate |
| InChIKey | KQBTZSUKLIBZJW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=CC=C1)N2C(=CC(=N2)C(C)(C)C)N |
Computed by PubChem (NCBI)