CAS 139264-24-7 appears in our catalog under these names: (R)-Zolmitriptan, Zolmitriptan R-Isomer, Zolmitriptan Impurity 3(R-Isomer). Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(4R)-4-[[3-[2-(dimethylamino)ethyl]-1H-indol-5-yl]methyl]-1,3-oxazolidin-2-one (CAS 139264-24-7) is a chemical compound with the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. IUPAC name: (4R)-4-[[3-[2-(dimethylamino)ethyl]-1H-indol-5-yl]methyl]-1,3-oxazolidin-2-one. InChIKey: ULSDMUVEXKOYBU-CYBMUJFWSA-N.
| Molecular formula | C16H21N3O2 |
|---|---|
| Molecular weight | 287.36 g/mol |
| IUPAC name | (4R)-4-[[3-[2-(dimethylamino)ethyl]-1H-indol-5-yl]methyl]-1,3-oxazolidin-2-one |
| InChIKey | ULSDMUVEXKOYBU-CYBMUJFWSA-N |
| SMILES | CN(C)CCC1=CNC2=C1C=C(C=C2)C[C@@H]3COC(=O)N3 |
Computed by PubChem (NCBI)