CAS 1142953-55-6 appears in our catalog under these names: (R)–2–(bromomethyl)–2,3–dihydrobenzo(b)(1,4)dioxine, (R)-2-(Bromomethyl)-2,3-dihydrobenzo[b][1,4]dioxine 95+%, (R)-2-(Bromomethyl)-2,3-dihydrobenzo[b][1,4]dioxine, 95+%, 95+%, (3R)-3-(Bromomethyl)-2,3-dihydro-1,4-benzodioxine, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g.
(3R)-3-(bromomethyl)-2,3-dihydro-1,4-benzodioxine (CAS 1142953-55-6) is a chemical compound with the molecular formula C9H9BrO2 and a molecular weight of 229.07 g/mol. IUPAC name: (3R)-3-(bromomethyl)-2,3-dihydro-1,4-benzodioxine. InChIKey: QYLFKNVZIFTCIY-ZETCQYMHSA-N.
| Molecular formula | C9H9BrO2 |
|---|---|
| Molecular weight | 229.07 g/mol |
| IUPAC name | (3R)-3-(bromomethyl)-2,3-dihydro-1,4-benzodioxine |
| InChIKey | QYLFKNVZIFTCIY-ZETCQYMHSA-N |
| SMILES | C1[C@@H](OC2=CC=CC=C2O1)CBr |
Computed by PubChem (NCBI)