Products 114339-94-5
CAS 114339-94-5 is the registry number for Aristolan-1(10)-en-9-ol. Offered by: MedChemExpress. Available pack sizes: 1 mg, 5 mg.
(1aR,3S,7R,7aR,7bS)-1,1,7,7a-tetramethyl-2,3,5,6,7,7b-hexahydro-1aH-cyclopropa[a]naphthalen-3-ol (CAS 114339-94-5) is a chemical compound with the molecular formula C15H24O and a molecular weight of 220.35 g/mol. IUPAC name: (1aR,3S,7R,7aR,7bS)-1,1,7,7a-tetramethyl-2,3,5,6,7,7b-hexahydro-1aH-cyclopropa[a]naphthalen-3-ol. InChIKey: ARZRZIVMAWEEFY-PYISLEMLSA-N.
| Molecular formula | C15H24O |
|---|---|
| Molecular weight | 220.35 g/mol |
| IUPAC name | (1aR,3S,7R,7aR,7bS)-1,1,7,7a-tetramethyl-2,3,5,6,7,7b-hexahydro-1aH-cyclopropa[a]naphthalen-3-ol |
| InChIKey | ARZRZIVMAWEEFY-PYISLEMLSA-N |
| SMILES | C[C@@H]1CCC=C2[C@]1([C@H]3[C@H](C3(C)C)C[C@@H]2O)C |
Computed by PubChem (NCBI)