CAS 1143504-17-9 is the registry number for Methyl 2-(tert-butyl)-5-methyloxazole-4-carboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Methyl 2-tert-butyl-5-methyl-1,3-oxazole-4-carboxylate (CAS 1143504-17-9) is a chemical compound with the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. IUPAC name: methyl 2-tert-butyl-5-methyl-1,3-oxazole-4-carboxylate. InChIKey: KBROJNYEJFGQKA-UHFFFAOYSA-N.
| Molecular formula | C10H15NO3 |
|---|---|
| Molecular weight | 197.23 g/mol |
| IUPAC name | methyl 2-tert-butyl-5-methyl-1,3-oxazole-4-carboxylate |
| InChIKey | KBROJNYEJFGQKA-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(O1)C(C)(C)C)C(=O)OC |
Computed by PubChem (NCBI)