CAS 1144483-21-5 is the registry number for 2-(1,3-Benzodioxol-5-yloxy)-4-methyl-1,3-thiazole-5-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-(1,3-benzodioxol-5-yloxy)-4-methyl-1,3-thiazole-5-carboxylic acid (CAS 1144483-21-5) is a chemical compound with the molecular formula C12H9NO5S and a molecular weight of 279.27 g/mol. IUPAC name: 2-(1,3-benzodioxol-5-yloxy)-4-methyl-1,3-thiazole-5-carboxylic acid. InChIKey: XWMCYILKSZFGBP-UHFFFAOYSA-N.
| Molecular formula | C12H9NO5S |
|---|---|
| Molecular weight | 279.27 g/mol |
| IUPAC name | 2-(1,3-benzodioxol-5-yloxy)-4-methyl-1,3-thiazole-5-carboxylic acid |
| InChIKey | XWMCYILKSZFGBP-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)OC2=CC3=C(C=C2)OCO3)C(=O)O |
Computed by PubChem (NCBI)