Products 934155-61-0
CAS 934155-61-0 is the registry number for 5-[(4-Nitrophenoxy)methyl]thiophene-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
5-[(4-nitrophenoxy)methyl]thiophene-2-carboxylic acid (CAS 934155-61-0) is a chemical compound with the molecular formula C12H9NO5S and a molecular weight of 279.27 g/mol. IUPAC name: 5-[(4-nitrophenoxy)methyl]thiophene-2-carboxylic acid. InChIKey: YDCCJPLIMBMCPX-UHFFFAOYSA-N.
| Molecular formula | C12H9NO5S |
|---|---|
| Molecular weight | 279.27 g/mol |
| IUPAC name | 5-[(4-nitrophenoxy)methyl]thiophene-2-carboxylic acid |
| InChIKey | YDCCJPLIMBMCPX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])OCC2=CC=C(S2)C(=O)O |
Computed by PubChem (NCBI)