Products 503827-52-9
CAS 503827-52-9 is the registry number for [3-(2,4-Dioxothiazolidin-5-ylidenemethyl)phenoxy]acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
2-[3-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetic acid (CAS 503827-52-9) is a chemical compound with the molecular formula C12H9NO5S and a molecular weight of 279.27 g/mol. IUPAC name: 2-[3-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetic acid. InChIKey: LNWKDMRQWSDYCU-WEVVVXLNSA-N.
| Molecular formula | C12H9NO5S |
|---|---|
| Molecular weight | 279.27 g/mol |
| IUPAC name | 2-[3-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetic acid |
| InChIKey | LNWKDMRQWSDYCU-WEVVVXLNSA-N |
| SMILES | C1=CC(=CC(=C1)OCC(=O)O)/C=C/2\C(=O)NC(=O)S2 |
Computed by PubChem (NCBI)