Products 114510-14-4
CAS 114510-14-4 is the registry number for ACETIC ANHYDRIDE-13C4, 99 ATOM % 13C. Offered by: Sigma-Aldrich. Available pack sizes: 250MG.
Acetyl acetate (CAS 114510-14-4) is a chemical compound with the molecular formula C4H6O3 and a molecular weight of 106.059 g/mol. IUPAC name: acetyl acetate. InChIKey: WFDIJRYMOXRFFG-JCDJMFQYSA-N.
| Molecular formula | C4H6O3 |
|---|---|
| Molecular weight | 106.059 g/mol |
| IUPAC name | acetyl acetate |
| InChIKey | WFDIJRYMOXRFFG-JCDJMFQYSA-N |
| SMILES | [13CH3][13C](=O)O[13C](=O)[13CH3] |
Computed by PubChem (NCBI)