Products 285977-77-7
CAS 285977-77-7 is the registry number for ACETIC ANHYDRIDE-13C4,D6 99 ATOM % 13C,. Offered by: Sigma-Aldrich. Available pack sizes: 100MG.
(2,2,2-trideuterioacetyl) 2,2,2-trideuterioacetate (CAS 285977-77-7) is a chemical compound with the molecular formula C4H6O3 and a molecular weight of 112.096 g/mol. IUPAC name: (2,2,2-trideuterioacetyl) 2,2,2-trideuterioacetate. InChIKey: WFDIJRYMOXRFFG-YGFKJJKOSA-N.
| Molecular formula | C4H6O3 |
|---|---|
| Molecular weight | 112.096 g/mol |
| IUPAC name | (2,2,2-trideuterioacetyl) 2,2,2-trideuterioacetate |
| InChIKey | WFDIJRYMOXRFFG-YGFKJJKOSA-N |
| SMILES | [2H][13C]([2H])([2H])[13C](=O)O[13C](=O)[13C]([2H])([2H])[2H] |
Computed by PubChem (NCBI)