Products 16649-49-3
CAS 16649-49-3 appears in our catalog under these names: Acetic Anhydride-d6, 99 atom % D, min 98% Chemical Purity, Acetic Anhydride–d6, Acetic anhydride-d6, Acetic anhydride-d6, for NMR, 98.5 atom % D, Acetic anhydride-D6, 99+ atom % D. Offered by: CDN, GLPBio, Biosynth, Thermo Scientific (Acros), Sigma-Aldrich. Available pack sizes: 5g, 250mg, 500mg, 5ML, 1G.
(2,2,2-trideuterioacetyl) 2,2,2-trideuterioacetate (CAS 16649-49-3) is a chemical compound with the molecular formula C4H6O3 and a molecular weight of 108.13 g/mol. IUPAC name: (2,2,2-trideuterioacetyl) 2,2,2-trideuterioacetate. InChIKey: WFDIJRYMOXRFFG-WFGJKAKNSA-N.
| Molecular formula | C4H6O3 |
|---|---|
| Molecular weight | 108.13 g/mol |
| IUPAC name | (2,2,2-trideuterioacetyl) 2,2,2-trideuterioacetate |
| InChIKey | WFDIJRYMOXRFFG-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])C(=O)OC(=O)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)