Products 114526-46-4
CAS 114526-46-4 appears in our catalog under these names: Imazamox Impurity 6, Imazamox Methyl Ester, >95% (HPLC), Imazamox-methyl, Imazamox methyl ester. Offered by: Hubei YoungXin, TRC, Dr. Ehrenstorfer, Biosynth, HPC Standards. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 1g, 250mg, 1x10mg.
Methyl 5-(methoxymethyl)-2-(4-methyl-5-oxo-4-propan-2-yl-1H-imidazol-2-yl)pyridine-3-carboxylate (CAS 114526-46-4) is a chemical compound with the molecular formula C16H21N3O4 and a molecular weight of 319.36 g/mol. IUPAC name: methyl 5-(methoxymethyl)-2-(4-methyl-5-oxo-4-propan-2-yl-1H-imidazol-2-yl)pyridine-3-carboxylate. InChIKey: WTJDEAVBSGKUGF-UHFFFAOYSA-N.
| Molecular formula | C16H21N3O4 |
|---|---|
| Molecular weight | 319.36 g/mol |
| IUPAC name | methyl 5-(methoxymethyl)-2-(4-methyl-5-oxo-4-propan-2-yl-1H-imidazol-2-yl)pyridine-3-carboxylate |
| InChIKey | WTJDEAVBSGKUGF-UHFFFAOYSA-N |
| SMILES | CC(C)C1(C(=O)NC(=N1)C2=C(C=C(C=N2)COC)C(=O)OC)C |
Computed by PubChem (NCBI)
Synonyms:
Imazamox Methyl Ester, Imazamox-methyl