Products 193148-60-6
CAS 193148-60-6 is the registry number for Boc-L-Ser(Bzl)-CHN2. Offered by: Creative Peptides. Available pack sizes: 1g.
Tert-butyl N-[(2S)-4-diazo-3-oxo-1-phenylmethoxybutan-2-yl]carbamate (CAS 193148-60-6) is a chemical compound with the molecular formula C16H21N3O4 and a molecular weight of 319.36 g/mol. IUPAC name: tert-butyl N-[(2S)-4-diazo-3-oxo-1-phenylmethoxybutan-2-yl]carbamate. InChIKey: QSUSHJCTLYBLNG-ZDUSSCGKSA-N.
| Molecular formula | C16H21N3O4 |
|---|---|
| Molecular weight | 319.36 g/mol |
| IUPAC name | tert-butyl N-[(2S)-4-diazo-3-oxo-1-phenylmethoxybutan-2-yl]carbamate |
| InChIKey | QSUSHJCTLYBLNG-ZDUSSCGKSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](COCC1=CC=CC=C1)C(=O)C=[N+]=[N-] |
Computed by PubChem (NCBI)