Products 54322-77-9
CAS 54322-77-9 appears in our catalog under these names: H-Orn-betaNA, H-Orn-betaNA carbonate salt. Offered by: Creative Peptides, Biosynth. Available pack sizes: 1g, 5g, 10g, 25g.
Carbonic acid;2,5-diamino-N-naphthalen-2-ylpentanamide (CAS 54322-77-9) is a chemical compound with the molecular formula C16H21N3O4 and a molecular weight of 319.36 g/mol. IUPAC name: carbonic acid;2,5-diamino-N-naphthalen-2-ylpentanamide. InChIKey: NVUXEINXRSYOMP-UHFFFAOYSA-N.
| Molecular formula | C16H21N3O4 |
|---|---|
| Molecular weight | 319.36 g/mol |
| IUPAC name | carbonic acid;2,5-diamino-N-naphthalen-2-ylpentanamide |
| InChIKey | NVUXEINXRSYOMP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)NC(=O)C(CCCN)N.C(=O)(O)O |
Computed by PubChem (NCBI)