Products 2643374-92-7
CAS 2643374-92-7 is the registry number for 1-(tert-Butyl) 2-methyl (4R)-4-hydroxypyrrolidine-1,2-dicarboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-O-tert-butyl 2-O-methyl (4R)-4-hydroxypyrrolidine-1,2-dicarboxylate (CAS 2643374-92-7) is a chemical compound with the molecular formula C11H19NO5 and a molecular weight of 245.27 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (4R)-4-hydroxypyrrolidine-1,2-dicarboxylate. InChIKey: MZMNEDXVUJLQAF-GVHYBUMESA-N.
| Molecular formula | C11H19NO5 |
|---|---|
| Molecular weight | 245.27 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (4R)-4-hydroxypyrrolidine-1,2-dicarboxylate |
| InChIKey | MZMNEDXVUJLQAF-GVHYBUMESA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](CC1C(=O)OC)O |
Computed by PubChem (NCBI)