Products 1145678-10-9
CAS 1145678-10-9 is the registry number for (S)-2-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)-3-(6-aminopyridin-3-yl)propanoic acid, 98%, 98%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g, 25g.
(2S)-3-(6-amino-3-pyridinyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 1145678-10-9) is a chemical compound with the molecular formula C23H21N3O4 and a molecular weight of 403.4 g/mol. IUPAC name: (2S)-3-(6-amino-3-pyridinyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: FXSMZIKFQRNYDD-FQEVSTJZSA-N.
| Molecular formula | C23H21N3O4 |
|---|---|
| Molecular weight | 403.4 g/mol |
| IUPAC name | (2S)-3-(6-amino-3-pyridinyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | FXSMZIKFQRNYDD-FQEVSTJZSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=CN=C(C=C4)N)C(=O)O |
Computed by PubChem (NCBI)