CAS 1609405-34-6 appears in our catalog under these names: N-Ethyl Tadalafil, N-Desmethyl, N-Ethyl Tadalafil, >95% (HPLC), Tadalafil-N-ethyl, N-Ethyl Tadalafil 98%, N-Desmethyl, N-Ethyl Tadalafil, 98%, 98%. Offered by: Chemat Brand, TRC, TargetMol, Biosynth, Ambeed. Available pack sizes: on request, 10mg, 1mg, 5mg, 100mg, 25mg, 50mg, 250mg.
(2R,8R)-2-(1,3-benzodioxol-5-yl)-6-ethyl-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione (CAS 1609405-34-6) is a chemical compound with the molecular formula C23H21N3O4 and a molecular weight of 403.4 g/mol. IUPAC name: (2R,8R)-2-(1,3-benzodioxol-5-yl)-6-ethyl-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione. InChIKey: QGNIMKVVHAXCSK-VGOFRKELSA-N.
| Molecular formula | C23H21N3O4 |
|---|---|
| Molecular weight | 403.4 g/mol |
| IUPAC name | (2R,8R)-2-(1,3-benzodioxol-5-yl)-6-ethyl-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
| InChIKey | QGNIMKVVHAXCSK-VGOFRKELSA-N |
| SMILES | CCN1CC(=O)N2[C@@H](C1=O)CC3=C([C@H]2C4=CC5=C(C=C4)OCO5)NC6=CC=CC=C36 |
Computed by PubChem (NCBI)