Products 1242328-82-0
CAS 1242328-82-0 appears in our catalog under these names: DS-6930, DS-6930, 98%, 3-((6-((3,5-Dimethylpyridin-2-yl)oxy)-1-methyl-1H-benzo[d]imidazol-2-yl)methoxy)benzoic acid, 98%. Offered by: Biosynth, MedChemExpress, Ambeed, BLDpharm. Available pack sizes: 10mg, 25mg, 50mg, Get quote, 5mg.
3-[[6-[(3,5-dimethyl-2-pyridinyl)oxy]-1-methylbenzimidazol-2-yl]methoxy]benzoic acid (CAS 1242328-82-0) is a chemical compound with the molecular formula C23H21N3O4 and a molecular weight of 403.4 g/mol. IUPAC name: 3-[[6-[(3,5-dimethyl-2-pyridinyl)oxy]-1-methylbenzimidazol-2-yl]methoxy]benzoic acid. InChIKey: GEGLFSVXCSGSOB-UHFFFAOYSA-N.
| Molecular formula | C23H21N3O4 |
|---|---|
| Molecular weight | 403.4 g/mol |
| IUPAC name | 3-[[6-[(3,5-dimethyl-2-pyridinyl)oxy]-1-methylbenzimidazol-2-yl]methoxy]benzoic acid |
| InChIKey | GEGLFSVXCSGSOB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N=C1)OC2=CC3=C(C=C2)N=C(N3C)COC4=CC=CC(=C4)C(=O)O)C |
Computed by PubChem (NCBI)
Synonyms:
orb1688062, RTF