CAS 1581755-42-1 is the registry number for SARS-CoV-2 PLpro-IN-2. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[(4-chlorophenyl)methyl]-1-[(1R)-1-naphthalen-1-ylethyl]piperidine-4-carboxamide (CAS 1581755-42-1) is a chemical compound with the molecular formula C25H27ClN2O and a molecular weight of 406.9 g/mol. IUPAC name: N-[(4-chlorophenyl)methyl]-1-[(1R)-1-naphthalen-1-ylethyl]piperidine-4-carboxamide. InChIKey: WYSVTAFOGXZFNZ-GOSISDBHSA-N.
| Molecular formula | C25H27ClN2O |
|---|---|
| Molecular weight | 406.9 g/mol |
| IUPAC name | N-[(4-chlorophenyl)methyl]-1-[(1R)-1-naphthalen-1-ylethyl]piperidine-4-carboxamide |
| InChIKey | WYSVTAFOGXZFNZ-GOSISDBHSA-N |
| SMILES | C[C@H](C1=CC=CC2=CC=CC=C21)N3CCC(CC3)C(=O)NCC4=CC=C(C=C4)Cl |
Computed by PubChem (NCBI)