CAS 1146616-49-0 is the registry number for 2',6'-Di(1H-pyrazol-1-yl)-3,4'-bipyridine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2,6-di(pyrazol-1-yl)-4-pyridin-3-ylpyridine (CAS 1146616-49-0) is a chemical compound with the molecular formula C16H12N6 and a molecular weight of 288.31 g/mol. IUPAC name: 2,6-di(pyrazol-1-yl)-4-pyridin-3-ylpyridine. InChIKey: BVWFCZUDQDPXTJ-UHFFFAOYSA-N.
| Molecular formula | C16H12N6 |
|---|---|
| Molecular weight | 288.31 g/mol |
| IUPAC name | 2,6-di(pyrazol-1-yl)-4-pyridin-3-ylpyridine |
| InChIKey | BVWFCZUDQDPXTJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C2=CC(=NC(=C2)N3C=CC=N3)N4C=CC=N4 |
Computed by PubChem (NCBI)