CAS 2057437-56-4 appears in our catalog under these names: 4,4'–Di(4H–1,2,4–triazol–4–yl)–1,1'–biphenyl, 4,4-di(4H-1,2,4-triazol-4-yl)-1,1-biphenyl, 97%, 97%, 4,4'-Di(4H-1,2,4-triazol-4-yl)-1,1'-biphenyl, 98%, 4,4'-Di(4H-1,2,4-triazol-4-yl)-1,1'-biphenyl, 97%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 100mg, 250mg, 5g.
4-[4-[4-(1,2,4-triazol-4-yl)phenyl]phenyl]-1,2,4-triazole (CAS 2057437-56-4) is a chemical compound with the molecular formula C16H12N6 and a molecular weight of 288.31 g/mol. IUPAC name: 4-[4-[4-(1,2,4-triazol-4-yl)phenyl]phenyl]-1,2,4-triazole. InChIKey: BBMVATNCFFPTEB-UHFFFAOYSA-N.
| Molecular formula | C16H12N6 |
|---|---|
| Molecular weight | 288.31 g/mol |
| IUPAC name | 4-[4-[4-(1,2,4-triazol-4-yl)phenyl]phenyl]-1,2,4-triazole |
| InChIKey | BBMVATNCFFPTEB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)N3C=NN=C3)N4C=NN=C4 |
Computed by PubChem (NCBI)