CAS 1642849-37-3 appears in our catalog under these names: 4,4'–Di(1H–1,2,4–triazol–1–yl)–1,1'–biphenyl, 4,4'-Di(1H-1,2,4-triazol-1-yl)-1,1'-biphenyl, 4,4'-Di(1H-1,2,4-triazol-1-yl)-1,1'-biphenyl, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
1-[4-[4-(1,2,4-triazol-1-yl)phenyl]phenyl]-1,2,4-triazole (CAS 1642849-37-3) is a chemical compound with the molecular formula C16H12N6 and a molecular weight of 288.31 g/mol. IUPAC name: 1-[4-[4-(1,2,4-triazol-1-yl)phenyl]phenyl]-1,2,4-triazole. InChIKey: QIZZACSTTKRQFN-UHFFFAOYSA-N.
| Molecular formula | C16H12N6 |
|---|---|
| Molecular weight | 288.31 g/mol |
| IUPAC name | 1-[4-[4-(1,2,4-triazol-1-yl)phenyl]phenyl]-1,2,4-triazole |
| InChIKey | QIZZACSTTKRQFN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)N3C=NC=N3)N4C=NC=N4 |
Computed by PubChem (NCBI)