CAS 1146955-04-5 appears in our catalog under these names: 4-Bromo-1-((tert-butoxy)carbonyl)piperidine-4-carboxylic acid, 98%, 4-Bromo-1-((tert-butoxy)carbonyl)piperidine-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 50mg, 0,5g.
4-bromo-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid (CAS 1146955-04-5) is a chemical compound with the molecular formula C11H18BrNO4 and a molecular weight of 308.17 g/mol. IUPAC name: 4-bromo-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid. InChIKey: VNILBVOEUDJGJN-UHFFFAOYSA-N.
| Molecular formula | C11H18BrNO4 |
|---|---|
| Molecular weight | 308.17 g/mol |
| IUPAC name | 4-bromo-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid |
| InChIKey | VNILBVOEUDJGJN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)(C(=O)O)Br |
Computed by PubChem (NCBI)