Products 865701-97-9

CAS 865701-97-9 is the registry number for L-N-t-Boc-2-bromomethyl Glycine Allyl Ester. Offered by: TRC. Available pack sizes: 100mg, 250mg, 500mg.

Structural formula: {0} (CAS {1})

Prop-2-enyl 3-bromo-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (CAS 865701-97-9) is a chemical compound with the molecular formula C11H18BrNO4 and a molecular weight of 308.17 g/mol. IUPAC name: prop-2-enyl 3-bromo-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate. InChIKey: XDOUMZBQABKMPE-UHFFFAOYSA-N.

Identity
Molecular formulaC11H18BrNO4
Molecular weight308.17 g/mol
IUPAC nameprop-2-enyl 3-bromo-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate
InChIKeyXDOUMZBQABKMPE-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC(CBr)C(=O)OCC=C

Computed by PubChem (NCBI)