CAS 334999-29-0 is the registry number for (4S)-1-Boc-4-bromo-L-proline methyl ester, 95%. Offered by: AmBeed. Available pack sizes: 5g.
1-O-tert-butyl 2-O-methyl (2S,4S)-4-bromopyrrolidine-1,2-dicarboxylate (CAS 334999-29-0) is a chemical compound with the molecular formula C11H18BrNO4 and a molecular weight of 308.17 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2S,4S)-4-bromopyrrolidine-1,2-dicarboxylate. InChIKey: TXQUSDPQTQXELO-YUMQZZPRSA-N.
| Molecular formula | C11H18BrNO4 |
|---|---|
| Molecular weight | 308.17 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2S,4S)-4-bromopyrrolidine-1,2-dicarboxylate |
| InChIKey | TXQUSDPQTQXELO-YUMQZZPRSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](C[C@H]1C(=O)OC)Br |
Computed by PubChem (NCBI)