CAS 114698-30-5 is the registry number for 2,5,6-Trimethyl-3-oxo-2,3-dihydropyridazine-4-carbothioamide, 98%. Offered by: AmBeed. Available pack sizes: 5g, 10g.
2,5,6-trimethyl-3-oxopyridazine-4-carbothioamide (CAS 114698-30-5) is a chemical compound with the molecular formula C8H11N3OS and a molecular weight of 197.26 g/mol. IUPAC name: 2,5,6-trimethyl-3-oxopyridazine-4-carbothioamide. InChIKey: FPJJNQXLIVTTNU-UHFFFAOYSA-N.
| Molecular formula | C8H11N3OS |
|---|---|
| Molecular weight | 197.26 g/mol |
| IUPAC name | 2,5,6-trimethyl-3-oxopyridazine-4-carbothioamide |
| InChIKey | FPJJNQXLIVTTNU-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)N(N=C1C)C)C(=S)N |
Computed by PubChem (NCBI)