CAS 1147-29-1 is the registry number for 8-(2-Hydroxypropan-2-yl)-8,9-dihydro-2H-furo[2,3-h]chromen-2-one, 99+%. Offered by: Chemat Brand. Available pack sizes: on request.
Columbianetin is the angular furanocoumarin analogue of the linear furanocoumarin marmesin. It is a furanocoumarin and a tertiary alcohol.
Source: ChEBI
| Molecular formula | C14H14O4 |
|---|---|
| Molecular weight | 246.26 g/mol |
| IUPAC name | 8-(2-hydroxypropan-2-yl)-8,9-dihydrofuro[2,3-h]chromen-2-one |
| InChIKey | YRAQEMCYCSSHJG-UHFFFAOYSA-N |
| SMILES | CC(C)(C1CC2=C(O1)C=CC3=C2OC(=O)C=C3)O |
Computed by PubChem (NCBI)