Products 114720-21-7
CAS 114720-21-7 is the registry number for Etodolac Impurity 18. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
Methyl 2-(1,8-diethyl-6-hydroxy-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)acetate (CAS 114720-21-7) is a chemical compound with the molecular formula C18H23NO4 and a molecular weight of 317.4 g/mol. IUPAC name: methyl 2-(1,8-diethyl-6-hydroxy-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)acetate. InChIKey: LUHKABLAXAOWFT-UHFFFAOYSA-N.
| Molecular formula | C18H23NO4 |
|---|---|
| Molecular weight | 317.4 g/mol |
| IUPAC name | methyl 2-(1,8-diethyl-6-hydroxy-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)acetate |
| InChIKey | LUHKABLAXAOWFT-UHFFFAOYSA-N |
| SMILES | CCC1=C2C(=CC(=C1)O)C3=C(N2)C(OCC3)(CC)CC(=O)OC |
Computed by PubChem (NCBI)