Products 114724-41-3
CAS 114724-41-3 appears in our catalog under these names: 2-(2-Aminophenylthio)benzoic Acid Hydrochloride, 2-((2-Aminophenyl)sulfanyl)benzoic acid hydrochloride. Offered by: TRC, Biosynth. Available pack sizes: 2,5g, 1g, 100mg.
2-(2-aminophenyl)sulfanylbenzoic acid;hydrochloride (CAS 114724-41-3) is a chemical compound with the molecular formula C13H12ClNO2S and a molecular weight of 281.76 g/mol. IUPAC name: 2-(2-aminophenyl)sulfanylbenzoic acid;hydrochloride. InChIKey: WMGIFRVMMAEDPO-UHFFFAOYSA-N.
| Molecular formula | C13H12ClNO2S |
|---|---|
| Molecular weight | 281.76 g/mol |
| IUPAC name | 2-(2-aminophenyl)sulfanylbenzoic acid;hydrochloride |
| InChIKey | WMGIFRVMMAEDPO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)SC2=CC=CC=C2N.Cl |
Computed by PubChem (NCBI)
Synonyms:
2-[(2-aminophenyl)thio]benzoic acid hydrochloride, 2-((2-Aminophenyl)thio)benzoic acid hydrochloride, 2-[(2-aminophenyl)sulfanyl]benzoic acid hydrochloride, 2-(2-aminophenyl)sulfanylbenzoic acid;hydrochloride, 2-(2-aminophenylthio)benzoic acid hydrochloride, Quetiapine Impurity SJ, 2-((2-Aminophenyl)thio)benzoicacidhydrochloride