Products 114741-22-9
CAS 114741-22-9 appears in our catalog under these names: 7-Chloro-4-oxo-4h-chromene-2-carboxylic acid, 95%, 7-Chloro-4-oxo-4H-chromene-2-carboxylic Acid, >95% (HPLC), 7–Chloro–4–oxo–4H–chromene–2–carboxylic acid, 7-Chloro-4-oxo-4H-chromene-2-carboxylic acid 95%, 7-Chloro-4-oxo-4H-chromene-2-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, TRC, GLPBio, Ambeed, Chemat. Available pack sizes: 100mg, 5g, 1g, 250mg, 10mg, 50mg.
7-chloro-4-oxochromene-2-carboxylic acid (CAS 114741-22-9) is a chemical compound with the molecular formula C10H5ClO4 and a molecular weight of 224.59 g/mol. IUPAC name: 7-chloro-4-oxochromene-2-carboxylic acid. InChIKey: QTAXIAZVGOANTN-UHFFFAOYSA-N.
| Molecular formula | C10H5ClO4 |
|---|---|
| Molecular weight | 224.59 g/mol |
| IUPAC name | 7-chloro-4-oxochromene-2-carboxylic acid |
| InChIKey | QTAXIAZVGOANTN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)OC(=CC2=O)C(=O)O |
Computed by PubChem (NCBI)