CAS 51085-92-8 is the registry number for 6-Chloro-4-oxo-4H-chromene-3-carboxylic acid, 97%. Offered by: AmBeed. Available pack sizes: 100mg, 250mg.
6-chloro-4-oxochromene-3-carboxylic acid (CAS 51085-92-8) is a chemical compound with the molecular formula C10H5ClO4 and a molecular weight of 224.59 g/mol. IUPAC name: 6-chloro-4-oxochromene-3-carboxylic acid. InChIKey: ATDTYCFXRNCJHO-UHFFFAOYSA-N.
| Molecular formula | C10H5ClO4 |
|---|---|
| Molecular weight | 224.59 g/mol |
| IUPAC name | 6-chloro-4-oxochromene-3-carboxylic acid |
| InChIKey | ATDTYCFXRNCJHO-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)C(=O)C(=CO2)C(=O)O |
Computed by PubChem (NCBI)