Products 1147557-74-1
CAS 1147557-74-1 appears in our catalog under these names: 2,6-Difluoro-4-(methylsulfonyl)aniline, 95%, 2，6–Difluoro–4–(methylsulfonyl)aniline, 2,6-Difluoro-4-(methylsulfonyl)aniline 95%, 2,6-Difluoro-4-(methylsulfonyl)aniline, 95%, 95%, 2,6-Difluoro-4-(methylsulfonyl)aniline, ≥95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg.
2,6-difluoro-4-methylsulfonylaniline (CAS 1147557-74-1) is a chemical compound with the molecular formula C7H7F2NO2S and a molecular weight of 207.20 g/mol. IUPAC name: 2,6-difluoro-4-methylsulfonylaniline. InChIKey: CNSKTQPFHJZAAQ-UHFFFAOYSA-N.
| Molecular formula | C7H7F2NO2S |
|---|---|
| Molecular weight | 207.20 g/mol |
| IUPAC name | 2,6-difluoro-4-methylsulfonylaniline |
| InChIKey | CNSKTQPFHJZAAQ-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC(=C(C(=C1)F)N)F |
Computed by PubChem (NCBI)