CAS 256651-60-2 appears in our catalog under these names: (2,6-Difluorophenyl)methanesulfonamide, 95%, (2,6-Difluorophenyl)methanesulfonamide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
(2,6-difluorophenyl)methanesulfonamide (CAS 256651-60-2) is a chemical compound with the molecular formula C7H7F2NO2S and a molecular weight of 207.20 g/mol. IUPAC name: (2,6-difluorophenyl)methanesulfonamide. InChIKey: XMCMBLABGQFAJA-UHFFFAOYSA-N.
| Molecular formula | C7H7F2NO2S |
|---|---|
| Molecular weight | 207.20 g/mol |
| IUPAC name | (2,6-difluorophenyl)methanesulfonamide |
| InChIKey | XMCMBLABGQFAJA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)CS(=O)(=O)N)F |
Computed by PubChem (NCBI)