Products 1384430-88-9
CAS 1384430-88-9 appears in our catalog under these names: 2,4-Difluoro-5-methylbenzene-1-sulfonamide, 95%, 2,4-Difluoro-5-methylbenzene-1-sulfonamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 100mg.
2,4-difluoro-5-methylbenzenesulfonamide (CAS 1384430-88-9) is a chemical compound with the molecular formula C7H7F2NO2S and a molecular weight of 207.20 g/mol. IUPAC name: 2,4-difluoro-5-methylbenzenesulfonamide. InChIKey: VBZPZGFGXVLHCK-UHFFFAOYSA-N.
| Molecular formula | C7H7F2NO2S |
|---|---|
| Molecular weight | 207.20 g/mol |
| IUPAC name | 2,4-difluoro-5-methylbenzenesulfonamide |
| InChIKey | VBZPZGFGXVLHCK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1F)F)S(=O)(=O)N |
Computed by PubChem (NCBI)