CAS 1147565-46-5 appears in our catalog under these names: 1-Bromo-4-iodo-2,3,5,6-tetradeuteriumbenzene, 95%, 4-Bromoiodobenzene-d4, 99.69%. Offered by: Combi-blocks, MedChemExpress. Available pack sizes: 250mg, 1g, 1 g, 250 mg, 500 mg, 100 mg.
1-bromo-2,3,5,6-tetradeuterio-4-iodobenzene (CAS 1147565-46-5) is a chemical compound with the molecular formula C6H4BrI and a molecular weight of 286.93 g/mol. IUPAC name: 1-bromo-2,3,5,6-tetradeuterio-4-iodobenzene. InChIKey: UCCUXODGPMAHRL-RHQRLBAQSA-N.
| Molecular formula | C6H4BrI |
|---|---|
| Molecular weight | 286.93 g/mol |
| IUPAC name | 1-bromo-2,3,5,6-tetradeuterio-4-iodobenzene |
| InChIKey | UCCUXODGPMAHRL-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1Br)[2H])[2H])I)[2H] |
Computed by PubChem (NCBI)