CAS 1261170-84-6 is the registry number for 1-Bromo-4-iodobenzene-13C6, 98% 98%atom%13C. Offered by: Chemat Brand. Available pack sizes: on request.
1-bromo-4-iodo(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene (CAS 1261170-84-6) is a chemical compound with the molecular formula C6H4BrI and a molecular weight of 288.86 g/mol. IUPAC name: 1-bromo-4-iodo(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene. InChIKey: UCCUXODGPMAHRL-IDEBNGHGSA-N.
| Molecular formula | C6H4BrI |
|---|---|
| Molecular weight | 288.86 g/mol |
| IUPAC name | 1-bromo-4-iodo(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene |
| InChIKey | UCCUXODGPMAHRL-IDEBNGHGSA-N |
| SMILES | [13CH]1=[13CH][13C](=[13CH][13CH]=[13C]1Br)I |
Computed by PubChem (NCBI)