Products 2363787-31-7
CAS 2363787-31-7 is the registry number for 1-Bromo-3-iodobenzene-d4. Offered by: MedChemExpress. Available pack sizes: 500 mg, 1 g, 25 g, 10 g, 100 mg, 250 mg, 5 g.
1-bromo-2,3,4,6-tetradeuterio-5-iodobenzene (CAS 2363787-31-7) is a chemical compound with the molecular formula C6H4BrI and a molecular weight of 286.93 g/mol. IUPAC name: 1-bromo-2,3,4,6-tetradeuterio-5-iodobenzene. InChIKey: CTPUUDQIXKUAMO-RHQRLBAQSA-N.
| Molecular formula | C6H4BrI |
|---|---|
| Molecular weight | 286.93 g/mol |
| IUPAC name | 1-bromo-2,3,4,6-tetradeuterio-5-iodobenzene |
| InChIKey | CTPUUDQIXKUAMO-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])I)[2H])Br)[2H] |
Computed by PubChem (NCBI)