CAS 114761-39-6 appears in our catalog under these names: Voglibose Impurity 11, N-Methyl-b-D-glucopyranosylamine (hydrochloride or other salt). Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 1g.
(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-(methylamino)oxane-3,4,5-triol (CAS 114761-39-6) is a chemical compound with the molecular formula C7H15NO5 and a molecular weight of 193.20 g/mol. IUPAC name: (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-(methylamino)oxane-3,4,5-triol. InChIKey: HJFJVGRAUAAGDP-XUUWZHRGSA-N.
| Molecular formula | C7H15NO5 |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-(methylamino)oxane-3,4,5-triol |
| InChIKey | HJFJVGRAUAAGDP-XUUWZHRGSA-N |
| SMILES | CN[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O |
Computed by PubChem (NCBI)