CAS 828930-79-6 is the registry number for (2R,3R)-2-Aminopentan-3-ol. Offered by: TRC. Available pack sizes: 500mg.
(2R,3R)-2-aminopentan-3-ol;oxalic acid (CAS 828930-79-6) is a chemical compound with the molecular formula C7H15NO5 and a molecular weight of 193.20 g/mol. IUPAC name: (2R,3R)-2-aminopentan-3-ol;oxalic acid. InChIKey: IZWGWYUMJPJYDE-TYSVMGFPSA-N.
| Molecular formula | C7H15NO5 |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | (2R,3R)-2-aminopentan-3-ol;oxalic acid |
| InChIKey | IZWGWYUMJPJYDE-TYSVMGFPSA-N |
| SMILES | CC[C@H]([C@@H](C)N)O.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)