CAS 14133-36-9 is the registry number for (2R,3S,4S,5R,6R)-4-Amino-2-(hydroxymethyl)-6-methoxytetrahydro-2H-pyran-3,5-diol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,3S,4S,5R,6R)-4-amino-2-(hydroxymethyl)-6-methoxyoxane-3,5-diol (CAS 14133-36-9) is a chemical compound with the molecular formula C7H15NO5 and a molecular weight of 193.20 g/mol. IUPAC name: (2R,3S,4S,5R,6R)-4-amino-2-(hydroxymethyl)-6-methoxyoxane-3,5-diol. InChIKey: GJFIBNOHCLHAOT-IECVIRLLSA-N.
| Molecular formula | C7H15NO5 |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | (2R,3S,4S,5R,6R)-4-amino-2-(hydroxymethyl)-6-methoxyoxane-3,5-diol |
| InChIKey | GJFIBNOHCLHAOT-IECVIRLLSA-N |
| SMILES | CO[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)N)O |
Computed by PubChem (NCBI)