Products 1148-53-4
CAS 1148-53-4 is the registry number for N-(4-Hydroxyphenyl)-N,4-dimethylbenzamide. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
N-(4-hydroxyphenyl)-N,4-dimethylbenzamide (CAS 1148-53-4) is a chemical compound with the molecular formula C15H15NO2 and a molecular weight of 241.28 g/mol. IUPAC name: N-(4-hydroxyphenyl)-N,4-dimethylbenzamide. InChIKey: ZAXDQTZNODCHKM-UHFFFAOYSA-N.
| Molecular formula | C15H15NO2 |
|---|---|
| Molecular weight | 241.28 g/mol |
| IUPAC name | N-(4-hydroxyphenyl)-N,4-dimethylbenzamide |
| InChIKey | ZAXDQTZNODCHKM-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)N(C)C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)