CAS 114873-19-7 is the registry number for N-Boc-5-methoxy-D-tryptophan, 95%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
(2R)-3-(5-methoxy-1H-indol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 114873-19-7) is a chemical compound with the molecular formula C17H22N2O5 and a molecular weight of 334.4 g/mol. IUPAC name: (2R)-3-(5-methoxy-1H-indol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: RFEFILRKWWZSFK-CQSZACIVSA-N.
| Molecular formula | C17H22N2O5 |
|---|---|
| Molecular weight | 334.4 g/mol |
| IUPAC name | (2R)-3-(5-methoxy-1H-indol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | RFEFILRKWWZSFK-CQSZACIVSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC1=CNC2=C1C=C(C=C2)OC)C(=O)O |
Computed by PubChem (NCBI)