CAS 114920-51-3 is the registry number for 1,​3-​Dihydro-​benzo(c)​thiophene-​5-​sulfonyl chloride 2,​2-​dioxide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2,2-dioxo-1,3-dihydro-2-benzothiophene-5-sulfonyl chloride (CAS 114920-51-3) is a chemical compound with the molecular formula C8H7ClO4S2 and a molecular weight of 266.7 g/mol. IUPAC name: 2,2-dioxo-1,3-dihydro-2-benzothiophene-5-sulfonyl chloride. InChIKey: VIYDGWAWUOVMDW-UHFFFAOYSA-N.
| Molecular formula | C8H7ClO4S2 |
|---|---|
| Molecular weight | 266.7 g/mol |
| IUPAC name | 2,2-dioxo-1,3-dihydro-2-benzothiophene-5-sulfonyl chloride |
| InChIKey | VIYDGWAWUOVMDW-UHFFFAOYSA-N |
| SMILES | C1C2=C(CS1(=O)=O)C=C(C=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)