Products 114920-51-3

CAS 114920-51-3 is the registry number for 1,​3-​Dihydro-​benzo(c)​thiophene-​5-​sulfonyl chloride 2,​2-​dioxide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2,2-dioxo-1,3-dihydro-2-benzothiophene-5-sulfonyl chloride (CAS 114920-51-3) is a chemical compound with the molecular formula C8H7ClO4S2 and a molecular weight of 266.7 g/mol. IUPAC name: 2,2-dioxo-1,3-dihydro-2-benzothiophene-5-sulfonyl chloride. InChIKey: VIYDGWAWUOVMDW-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7ClO4S2
Molecular weight266.7 g/mol
IUPAC name2,2-dioxo-1,3-dihydro-2-benzothiophene-5-sulfonyl chloride
InChIKeyVIYDGWAWUOVMDW-UHFFFAOYSA-N
SMILESC1C2=C(CS1(=O)=O)C=C(C=C2)S(=O)(=O)Cl

Computed by PubChem (NCBI)