Products 1154979-84-6

CAS 1154979-84-6 appears in our catalog under these names: 2,3-Dihydrobenzo(b)thiophene-3-sulfonyl chloride 1,1-dioxide, 97%, 1,1-dioxo-2,3-dihydro-1-benzothiophene-3-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.

Structural formula: {0} (CAS {1})

1,1-dioxo-2,3-dihydro-1-benzothiophene-3-sulfonyl chloride (CAS 1154979-84-6) is a chemical compound with the molecular formula C8H7ClO4S2 and a molecular weight of 266.7 g/mol. IUPAC name: 1,1-dioxo-2,3-dihydro-1-benzothiophene-3-sulfonyl chloride. InChIKey: JBUKOSFZXFIOAW-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7ClO4S2
Molecular weight266.7 g/mol
IUPAC name1,1-dioxo-2,3-dihydro-1-benzothiophene-3-sulfonyl chloride
InChIKeyJBUKOSFZXFIOAW-UHFFFAOYSA-N
SMILESC1C(C2=CC=CC=C2S1(=O)=O)S(=O)(=O)Cl

Computed by PubChem (NCBI)