Products 208643-45-2

CAS 208643-45-2 is the registry number for 2,3-Dihydrobenzo(b)thiophene-6-sulphonyl chloride 1,1-dioxide. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

1,1-dioxo-2,3-dihydro-1-benzothiophene-6-sulfonyl chloride (CAS 208643-45-2) is a chemical compound with the molecular formula C8H7ClO4S2 and a molecular weight of 266.7 g/mol. IUPAC name: 1,1-dioxo-2,3-dihydro-1-benzothiophene-6-sulfonyl chloride. InChIKey: OTTLGROTQDMDSE-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7ClO4S2
Molecular weight266.7 g/mol
IUPAC name1,1-dioxo-2,3-dihydro-1-benzothiophene-6-sulfonyl chloride
InChIKeyOTTLGROTQDMDSE-UHFFFAOYSA-N
SMILESC1CS(=O)(=O)C2=C1C=CC(=C2)S(=O)(=O)Cl

Computed by PubChem (NCBI)