CAS 208643-45-2 is the registry number for 2,3-Dihydrobenzo(b)thiophene-6-sulphonyl chloride 1,1-dioxide. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
1,1-dioxo-2,3-dihydro-1-benzothiophene-6-sulfonyl chloride (CAS 208643-45-2) is a chemical compound with the molecular formula C8H7ClO4S2 and a molecular weight of 266.7 g/mol. IUPAC name: 1,1-dioxo-2,3-dihydro-1-benzothiophene-6-sulfonyl chloride. InChIKey: OTTLGROTQDMDSE-UHFFFAOYSA-N.
| Molecular formula | C8H7ClO4S2 |
|---|---|
| Molecular weight | 266.7 g/mol |
| IUPAC name | 1,1-dioxo-2,3-dihydro-1-benzothiophene-6-sulfonyl chloride |
| InChIKey | OTTLGROTQDMDSE-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)C2=C1C=CC(=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)