CAS 1149624-36-1 is the registry number for 3-(tert-Butyl) 6-ethyl (1R,5S)-9-methyl-7-oxo-3,9-diazabicyclo[3.3.1]nonane-3,6-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-O-tert-butyl 6-O-ethyl (1R,5S)-9-methyl-7-oxo-3,9-diazabicyclo[3.3.1]nonane-3,6-dicarboxylate (CAS 1149624-36-1) is a chemical compound with the molecular formula C16H26N2O5 and a molecular weight of 326.39 g/mol. IUPAC name: 3-O-tert-butyl 6-O-ethyl (1R,5S)-9-methyl-7-oxo-3,9-diazabicyclo[3.3.1]nonane-3,6-dicarboxylate. InChIKey: DDQLSUNZALBDML-KKPNGEORSA-N.
| Molecular formula | C16H26N2O5 |
|---|---|
| Molecular weight | 326.39 g/mol |
| IUPAC name | 3-O-tert-butyl 6-O-ethyl (1R,5S)-9-methyl-7-oxo-3,9-diazabicyclo[3.3.1]nonane-3,6-dicarboxylate |
| InChIKey | DDQLSUNZALBDML-KKPNGEORSA-N |
| SMILES | CCOC(=O)C1[C@H]2CN(C[C@H](N2C)CC1=O)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)